C21H25F3N2O4S — CID 172762827
1-[4-(azetidin-3-yl)phenyl]-3-(2,2,2-trifluoroethoxy)azetidine;4-methylbenzenesulfonic acid (PubChem CID 172762827) has the molecular formula C21H25F3N2O4S and a molecular weight of 458.50 g/mol. Its IUPAC name is 1-[4-(azetidin-3-yl)phenyl]-3-(2,2,2-trifluoroethoxy)azetidine;4-methylbenzenesulfonic acid.
| Compound Name | 1-[4-(azetidin-3-yl)phenyl]-3-(2,2,2-trifluoroethoxy)azetidine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 172762827 |
| Molecular Formula | C21H25F3N2O4S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 1-[4-(azetidin-3-yl)phenyl]-3-(2,2,2-trifluoroethoxy)azetidine;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.FC(F)(F)COC1CN(c2ccc(C3CNC3)cc2)C1 |
| InChI | InChI=1S/C14H17F3N2O.C7H8O3S/c15-14(16,17)9-20-13-7-19(8-13)12-3-1-10(2-4-12)11-5-18-6-11;1-6-2-4-7(5-3-6)11(8,9)10/h1-4,11,13,18H,5-9H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | LXMKRVLMOWBVMH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|