C16H17F3N2O4S — CID 174242581
5-(azetidin-3-yloxy)-2-(trifluoromethyl)pyridine;4-methylbenzenesulfonic acid (PubChem CID 174242581) has the molecular formula C16H17F3N2O4S and a molecular weight of 390.38 g/mol. Its IUPAC name is 5-(azetidin-3-yloxy)-2-(trifluoromethyl)pyridine;4-methylbenzenesulfonic acid.
| Compound Name | 5-(azetidin-3-yloxy)-2-(trifluoromethyl)pyridine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 174242581 |
| Molecular Formula | C16H17F3N2O4S |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 5-(azetidin-3-yloxy)-2-(trifluoromethyl)pyridine;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.FC(F)(F)c1ccc(OC2CNC2)cn1 |
| InChI | InChI=1S/C9H9F3N2O.C7H8O3S/c10-9(11,12)8-2-1-6(5-14-8)15-7-3-13-4-7;1-6-2-4-7(5-3-6)11(8,9)10/h1-2,5,7,13H,3-4H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | MOZQXUKBNIZLPB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|