C15H17F3N2O3S — CID 174705204
N-ethyl-6-(trifluoromethyl)pyridin-3-amine;4-methylbenzenesulfonic acid (PubChem CID 174705204) has the molecular formula C15H17F3N2O3S and a molecular weight of 362.37 g/mol. Its IUPAC name is N-ethyl-6-(trifluoromethyl)pyridin-3-amine;4-methylbenzenesulfonic acid.
| Compound Name | N-ethyl-6-(trifluoromethyl)pyridin-3-amine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 174705204 |
| Molecular Formula | C15H17F3N2O3S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-ethyl-6-(trifluoromethyl)pyridin-3-amine;4-methylbenzenesulfonic acid |
| SMILES | CCNc1ccc(C(F)(F)F)nc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C8H9F3N2.C7H8O3S/c1-2-12-6-3-4-7(13-5-6)8(9,10)11;1-6-2-4-7(5-3-6)11(8,9)10/h3-5,12H,2H2,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | HLYMNXPIZNHPPB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|