C13H23NO5S — CID 174628653
2-(2-hydroxypropan-2-ylamino)propan-2-ol;4-methylbenzenesulfonic acid (PubChem CID 174628653) has the molecular formula C13H23NO5S and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-(2-hydroxypropan-2-ylamino)propan-2-ol;4-methylbenzenesulfonic acid.
| Compound Name | 2-(2-hydroxypropan-2-ylamino)propan-2-ol;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 174628653 |
| Molecular Formula | C13H23NO5S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-(2-hydroxypropan-2-ylamino)propan-2-ol;4-methylbenzenesulfonic acid |
| SMILES | CC(C)(O)NC(C)(C)O.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H8O3S.C6H15NO2/c1-6-2-4-7(5-3-6)11(8,9)10;1-5(2,8)7-6(3,4)9/h2-5H,1H3,(H,8,9,10);7-9H,1-4H3 |
| InChIKey | XCVHOZGGYQCAPV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|