C19H21F3N2O4S — CID 174242589
4-methylbenzenesulfonic acid;6-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-2-azaspiro[3.3]heptane (PubChem CID 174242589) has the molecular formula C19H21F3N2O4S and a molecular weight of 430.45 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;6-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-2-azaspiro[3.3]heptane.
| Compound Name | 4-methylbenzenesulfonic acid;6-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-2-azaspiro[3.3]heptane |
|---|---|
| PubChem CID | 174242589 |
| Molecular Formula | C19H21F3N2O4S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-methylbenzenesulfonic acid;6-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-2-azaspiro[3.3]heptane |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.FC(F)(F)c1ccc(OC2CC3(CNC3)C2)cn1 |
| InChI | InChI=1S/C12H13F3N2O.C7H8O3S/c13-12(14,15)10-2-1-8(5-17-10)18-9-3-11(4-9)6-16-7-11;1-6-2-4-7(5-3-6)11(8,9)10/h1-2,5,9,16H,3-4,6-7H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | XZMGWQLXMPEDCI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|