C17H17NO3S — CID 172763009
2-benzoyl-1-(1,3-thiazol-1-ium-1-yl)cyclohexane-1-carboxylate (PubChem CID 172763009) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is 2-benzoyl-1-(1,3-thiazol-1-ium-1-yl)cyclohexane-1-carboxylate.
| Compound Name | 2-benzoyl-1-(1,3-thiazol-1-ium-1-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 172763009 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-benzoyl-1-(1,3-thiazol-1-ium-1-yl)cyclohexane-1-carboxylate |
| SMILES | O=C(c1ccccc1)C1CCCCC1(C(=O)[O-])[s+]1ccnc1 |
| InChI | InChI=1S/C17H17NO3S/c19-15(13-6-2-1-3-7-13)14-8-4-5-9-17(14,16(20)21)22-11-10-18-12-22/h1-3,6-7,10-12,14H,4-5,8-9H2 |
| InChIKey | LYDXNZGFROAPLG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 70.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|