C21H15ClFNO4 — CID 172763424
4-(4-chlorobenzoyl)-3-fluoro-2-(1-hydroxy-2-pyridin-2-ylethyl)benzoic acid (PubChem CID 172763424) has the molecular formula C21H15ClFNO4 and a molecular weight of 399.81 g/mol. Its IUPAC name is 4-(4-chlorobenzoyl)-3-fluoro-2-(1-hydroxy-2-pyridin-2-ylethyl)benzoic acid.
| Compound Name | 4-(4-chlorobenzoyl)-3-fluoro-2-(1-hydroxy-2-pyridin-2-ylethyl)benzoic acid |
|---|---|
| PubChem CID | 172763424 |
| Molecular Formula | C21H15ClFNO4 |
| Molecular Weight | 399.81 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 4-(4-chlorobenzoyl)-3-fluoro-2-(1-hydroxy-2-pyridin-2-ylethyl)benzoic acid |
| SMILES | O=C(c1ccc(Cl)cc1)c1ccc(C(=O)O)c(C(O)Cc2ccccn2)c1F |
| InChI | InChI=1S/C21H15ClFNO4/c22-13-6-4-12(5-7-13)20(26)16-9-8-15(21(27)28)18(19(16)23)17(25)11-14-3-1-2-10-24-14/h1-10,17,25H,11H2,(H,27,28) |
| InChIKey | LZNCWNXHBZDCEK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.81 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |