C21H18N2O4 — CID 174889246
4-(1,3-dipyridin-2-ylpropan-2-yl)benzene-1,3-dicarboxylic acid (PubChem CID 174889246) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is 4-(1,3-dipyridin-2-ylpropan-2-yl)benzene-1,3-dicarboxylic acid.
| Compound Name | 4-(1,3-dipyridin-2-ylpropan-2-yl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174889246 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 4-(1,3-dipyridin-2-ylpropan-2-yl)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(C(Cc2ccccn2)Cc2ccccn2)c(C(=O)O)c1 |
| InChI | InChI=1S/C21H18N2O4/c24-20(25)14-7-8-18(19(13-14)21(26)27)15(11-16-5-1-3-9-22-16)12-17-6-2-4-10-23-17/h1-10,13,15H,11-12H2,(H,24,25)(H,26,27) |
| InChIKey | YRIHBGCEFHXZDY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |