C34H37NSSi2 — CID 172770583
2-[9,9-diethyl-7-[4-(2-trimethylsilylethynyl)-1,3-benzothiazol-2-yl]fluoren-2-yl]ethynyl-trimethylsilane (PubChem CID 172770583) has the molecular formula C34H37NSSi2 and a molecular weight of 547.92 g/mol. Its IUPAC name is 2-[9,9-diethyl-7-[4-(2-trimethylsilylethynyl)-1,3-benzothiazol-2-yl]fluoren-2-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[9,9-diethyl-7-[4-(2-trimethylsilylethynyl)-1,3-benzothiazol-2-yl]fluoren-2-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 172770583 |
| Molecular Formula | C34H37NSSi2 |
| Molecular Weight | 547.92 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 2-[9,9-diethyl-7-[4-(2-trimethylsilylethynyl)-1,3-benzothiazol-2-yl]fluoren-2-yl]ethynyl-trimethylsilane |
| SMILES | CCC1(CC)c2cc(C#C[Si](C)(C)C)ccc2-c2ccc(-c3nc4c(C#C[Si](C)(C)C)cccc4s3)cc21 |
| InChI | InChI=1S/C34H37NSSi2/c1-9-34(10-2)29-22-24(18-20-37(3,4)5)14-16-27(29)28-17-15-26(23-30(28)34)33-35-32-25(19-21-38(6,7)8)12-11-13-31(32)36-33/h11-17,22-23H,9-10H2,1-8H3 |
| InChIKey | MWYQMUSIAGUWFF-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.92 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|