C31H33BrN2O5 — CID 172784343
6,7-dimethoxy-1-[1-(6-methoxynaphthalen-2-yl)ethyl]-2-[(4-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinoline;hydrobromide (PubChem CID 172784343) has the molecular formula C31H33BrN2O5 and a molecular weight of 593.52 g/mol. Its IUPAC name is 6,7-dimethoxy-1-[1-(6-methoxynaphthalen-2-yl)ethyl]-2-[(4-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinoline;hydrobromide.
| Compound Name | 6,7-dimethoxy-1-[1-(6-methoxynaphthalen-2-yl)ethyl]-2-[(4-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinoline;hydrobromide |
|---|---|
| PubChem CID | 172784343 |
| Molecular Formula | C31H33BrN2O5 |
| Molecular Weight | 593.52 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | 6,7-dimethoxy-1-[1-(6-methoxynaphthalen-2-yl)ethyl]-2-[(4-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinoline;hydrobromide |
| SMILES | Br.COc1ccc2cc(C(C)C3c4cc(OC)c(OC)cc4CCN3Cc3ccc([N+](=O)[O-])cc3)ccc2c1 |
| InChI | InChI=1S/C31H32N2O5.BrH/c1-20(22-7-8-24-16-27(36-2)12-9-23(24)15-22)31-28-18-30(38-4)29(37-3)17-25(28)13-14-32(31)19-21-5-10-26(11-6-21)33(34)35;/h5-12,15-18,20,31H,13-14,19H2,1-4H3;1H |
| InChIKey | ORJAIJNCJWSCBT-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.52 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|