About azanium;nonan-2-yl(dioctyl)phosphane;nitrate
azanium;nonan-2-yl(dioctyl)phosphane;nitrate (PubChem CID 172785276) has the molecular formula C25H57N2O3P
and a molecular weight of 464.72 g/mol. Its IUPAC name is azanium;nonan-2-yl(dioctyl)phosphane;nitrate.
Molecular Properties
| Compound Name | azanium;nonan-2-yl(dioctyl)phosphane;nitrate |
| PubChem CID | 172785276 |
| Molecular Formula | C25H57N2O3P |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.41 |
| IUPAC Name | azanium;nonan-2-yl(dioctyl)phosphane;nitrate |
| SMILES | CCCCCCCCP(CCCCCCCC)C(C)CCCCCCC.O=[N+]([O-])[O-].[NH4+] |
| InChI | InChI=1S/C25H53P.NO3.H3N/c1-5-8-11-14-17-20-23-26(24-21-18-15-12-9-6-2)25(4)22-19-16-13-10-7-3;2-1(3)4;/h25H,5-24H2,1-4H3;;1H3/q;-1;/p+1 |
| InChIKey | OUOJARQXMBYXBV-UHFFFAOYSA-O |
| XLogP | 10.08 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azanium;nonan-2-yl(dioctyl)phosphane;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;nonan-2-yl(dioctyl)phosphane;nitrate?
The IUPAC name of azanium;nonan-2-yl(dioctyl)phosphane;nitrate (CID 172785276) is azanium;nonan-2-yl(dioctyl)phosphane;nitrate.
What is the SMILES notation for azanium;nonan-2-yl(dioctyl)phosphane;nitrate?
The canonical SMILES for azanium;nonan-2-yl(dioctyl)phosphane;nitrate is CCCCCCCCP(CCCCCCCC)C(C)CCCCCCC.O=[N+]([O-])[O-].[NH4+].
What is the InChIKey of azanium;nonan-2-yl(dioctyl)phosphane;nitrate?
The InChIKey is OUOJARQXMBYXBV-UHFFFAOYSA-O. The full InChI is InChI=1S/C25H53P.NO3.H3N/c1-5-8-11-14-17-20-23-26(24-21-18-15-12-9-6-2)25(4)22-19-16-13-10-7-3;2-1(3)4;/h25H,5-24H2,1-4H3;;1H3/q;-1;/p+1.
What are the key properties of azanium;nonan-2-yl(dioctyl)phosphane;nitrate?
azanium;nonan-2-yl(dioctyl)phosphane;nitrate has a molecular weight of 464.72 g/mol, XLogP of 10.08, 21 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;nonan-2-yl(dioctyl)phosphane;nitrate is sourced from PubChem (CID 172785276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).