C8H18N2O3 — CID 172795158
3,5-ditert-butyl-1,2,4,3,5-trioxadiazolidine (PubChem CID 172795158) has the molecular formula C8H18N2O3 and a molecular weight of 190.24 g/mol. Its IUPAC name is 3,5-ditert-butyl-1,2,4,3,5-trioxadiazolidine.
| Compound Name | 3,5-ditert-butyl-1,2,4,3,5-trioxadiazolidine |
|---|---|
| PubChem CID | 172795158 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | 3,5-ditert-butyl-1,2,4,3,5-trioxadiazolidine |
| SMILES | CC(C)(C)n1oon(C(C)(C)C)o1 |
| InChI | InChI=1S/C8H18N2O3/c1-7(2,3)9-11-10(13-12-9)8(4,5)6/h1-6H3 |
| InChIKey | QCHFEOWAVVWVST-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |