About 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxazolidine
2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxazolidine (PubChem CID 123470902) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxazolidine.
Analyze 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxazolidine?
The IUPAC name of 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxazolidine (CID 123470902) is 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxazolidine.
What is the SMILES notation for 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxazolidine?
The canonical SMILES for 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxazolidine is CC(C)(C)N1OC(C)(C)C(C)(C)O1.
What is the InChIKey of 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxazolidine?
The InChIKey is KLFVSMXGVHMTCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-8(2,3)11-12-9(4,5)10(6,7)13-11/h1-7H3.
What are the key properties of 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxazolidine?
2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxazolidine has a molecular weight of 187.28 g/mol, XLogP of 2.52, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxazolidine is sourced from PubChem (CID 123470902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).