C10H22O3P+ — CID 23416973
4,4,5,5-tetramethyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2-dioxaphospholan-2-ium (PubChem CID 23416973) has the molecular formula C10H22O3P+ and a molecular weight of 221.26 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2-dioxaphospholan-2-ium.
| Compound Name | 4,4,5,5-tetramethyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2-dioxaphospholan-2-ium |
|---|---|
| PubChem CID | 23416973 |
| Molecular Formula | C10H22O3P+ |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(2-methylpropan-2-yl)oxy]-1,3,2-dioxaphospholan-2-ium |
| SMILES | CC(C)(C)O[PH+]1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H22O3P/c1-8(2,3)11-14-12-9(4,5)10(6,7)13-14/h14H,1-7H3/q+1 |
| InChIKey | UAPUNCFJDWFUOK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|