C11H23NO — CID 102095389
2-tert-butyl-4,4,5,5-tetramethyl-1,3-oxazolidine (PubChem CID 102095389) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is 2-tert-butyl-4,4,5,5-tetramethyl-1,3-oxazolidine.
| Compound Name | 2-tert-butyl-4,4,5,5-tetramethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 102095389 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 2-tert-butyl-4,4,5,5-tetramethyl-1,3-oxazolidine |
| SMILES | CC(C)(C)C1NC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C11H23NO/c1-9(2,3)8-12-10(4,5)11(6,7)13-8/h8,12H,1-7H3 |
| InChIKey | JOHUKKOPQAFTSR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |