C12H24O — CID 175708400
3-tert-butyl-2,2,4,4-tetramethylcyclobutan-1-ol (PubChem CID 175708400) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is 3-tert-butyl-2,2,4,4-tetramethylcyclobutan-1-ol.
| Compound Name | 3-tert-butyl-2,2,4,4-tetramethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 175708400 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | 3-tert-butyl-2,2,4,4-tetramethylcyclobutan-1-ol |
| SMILES | CC(C)(C)C1C(C)(C)C(O)C1(C)C |
| InChI | InChI=1S/C12H24O/c1-10(2,3)8-11(4,5)9(13)12(8,6)7/h8-9,13H,1-7H3 |
| InChIKey | ULJAOVXRDMZENC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |