C10H21NO — CID 95562197
(2S)-2-tert-butyl-3,4,4-trimethyl-1,3-oxazolidine (PubChem CID 95562197) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is (2S)-2-tert-butyl-3,4,4-trimethyl-1,3-oxazolidine.
| Compound Name | (2S)-2-tert-butyl-3,4,4-trimethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 95562197 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | (2S)-2-tert-butyl-3,4,4-trimethyl-1,3-oxazolidine |
| SMILES | CN1[C@H](C(C)(C)C)OCC1(C)C |
| InChI | InChI=1S/C10H21NO/c1-9(2,3)8-11(6)10(4,5)7-12-8/h8H,7H2,1-6H3/t8-/m0/s1 |
| InChIKey | SQHFTLCBKHQWQE-QMMMGPOBSA-N |
| XLogP | 2.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |