C15H16F2O5S — CID 172797600
[(3,4-difluorophenyl)sulfonyl-(3-oxocyclohexyl)methyl] acetate (PubChem CID 172797600) has the molecular formula C15H16F2O5S and a molecular weight of 346.35 g/mol. Its IUPAC name is [(3,4-difluorophenyl)sulfonyl-(3-oxocyclohexyl)methyl] acetate.
| Compound Name | [(3,4-difluorophenyl)sulfonyl-(3-oxocyclohexyl)methyl] acetate |
|---|---|
| PubChem CID | 172797600 |
| Molecular Formula | C15H16F2O5S |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | [(3,4-difluorophenyl)sulfonyl-(3-oxocyclohexyl)methyl] acetate |
| SMILES | CC(=O)OC(C1CCCC(=O)C1)S(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H16F2O5S/c1-9(18)22-15(10-3-2-4-11(19)7-10)23(20,21)12-5-6-13(16)14(17)8-12/h5-6,8,10,15H,2-4,7H2,1H3 |
| InChIKey | QKPLSGVLLJBPBY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |