C11H14BrN3O2 — CID 172802821
ethyl 2-amino-2-[(3-bromophenyl)methylhydrazinylidene]acetate (PubChem CID 172802821) has the molecular formula C11H14BrN3O2 and a molecular weight of 300.16 g/mol. Its IUPAC name is ethyl 2-amino-2-[(3-bromophenyl)methylhydrazinylidene]acetate.
| Compound Name | ethyl 2-amino-2-[(3-bromophenyl)methylhydrazinylidene]acetate |
|---|---|
| PubChem CID | 172802821 |
| Molecular Formula | C11H14BrN3O2 |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | ethyl 2-amino-2-[(3-bromophenyl)methylhydrazinylidene]acetate |
| SMILES | CCOC(=O)C(N)=NNCc1cccc(Br)c1 |
| InChI | InChI=1S/C11H14BrN3O2/c1-2-17-11(16)10(13)15-14-7-8-4-3-5-9(12)6-8/h3-6,14H,2,7H2,1H3,(H2,13,15) |
| InChIKey | RCGURBVBRVZWRQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|