C17H19N3O2 — CID 12857760
ethyl (2Z)-2-amino-2-[(2-benzylphenyl)hydrazinylidene]acetate (PubChem CID 12857760) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is ethyl (2Z)-2-amino-2-[(2-benzylphenyl)hydrazinylidene]acetate.
| Compound Name | ethyl (2Z)-2-amino-2-[(2-benzylphenyl)hydrazinylidene]acetate |
|---|---|
| PubChem CID | 12857760 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | ethyl (2Z)-2-amino-2-[(2-benzylphenyl)hydrazinylidene]acetate |
| SMILES | CCOC(=O)/C(N)=N/Nc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C17H19N3O2/c1-2-22-17(21)16(18)20-19-15-11-7-6-10-14(15)12-13-8-4-3-5-9-13/h3-11,19H,2,12H2,1H3,(H2,18,20) |
| InChIKey | BBMDKUKSTXEWKG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|