C21H19ClN2O2 — CID 68966447
ethyl 6-(2-benzylanilino)-5-chloropyridine-3-carboxylate (PubChem CID 68966447) has the molecular formula C21H19ClN2O2 and a molecular weight of 366.85 g/mol. Its IUPAC name is ethyl 6-(2-benzylanilino)-5-chloropyridine-3-carboxylate.
| Compound Name | ethyl 6-(2-benzylanilino)-5-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 68966447 |
| Molecular Formula | C21H19ClN2O2 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | ethyl 6-(2-benzylanilino)-5-chloropyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(Nc2ccccc2Cc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C21H19ClN2O2/c1-2-26-21(25)17-13-18(22)20(23-14-17)24-19-11-7-6-10-16(19)12-15-8-4-3-5-9-15/h3-11,13-14H,2,12H2,1H3,(H,23,24) |
| InChIKey | SQVAPMRPMJMLHW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |