C26H25F3N2O4S2 — CID 172803648
(2'-methylsulfanyl-6-phenylmethoxyspiro[2,3-dihydro-1H-naphthalene-4,7'-6,8-dihydro-5H-quinazoline]-4'-yl) trifluoromethanesulfonate (PubChem CID 172803648) has the molecular formula C26H25F3N2O4S2 and a molecular weight of 550.62 g/mol. Its IUPAC name is (2'-methylsulfanyl-6-phenylmethoxyspiro[2,3-dihydro-1H-naphthalene-4,7'-6,8-dihydro-5H-quinazoline]-4'-yl) trifluoromethanesulfonate.
| Compound Name | (2'-methylsulfanyl-6-phenylmethoxyspiro[2,3-dihydro-1H-naphthalene-4,7'-6,8-dihydro-5H-quinazoline]-4'-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 172803648 |
| Molecular Formula | C26H25F3N2O4S2 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | (2'-methylsulfanyl-6-phenylmethoxyspiro[2,3-dihydro-1H-naphthalene-4,7'-6,8-dihydro-5H-quinazoline]-4'-yl) trifluoromethanesulfonate |
| SMILES | CSc1nc2c(c(OS(=O)(=O)C(F)(F)F)n1)CCC1(CCCc3ccc(OCc4ccccc4)cc31)C2 |
| InChI | InChI=1S/C26H25F3N2O4S2/c1-36-24-30-22-15-25(13-11-20(22)23(31-24)35-37(32,33)26(27,28)29)12-5-8-18-9-10-19(14-21(18)25)34-16-17-6-3-2-4-7-17/h2-4,6-7,9-10,14H,5,8,11-13,15-16H2,1H3 |
| InChIKey | RFBLASFJRHFSLT-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|