C25H26N2O2S — CID 167092978
2'-methylsulfanyl-6-phenylmethoxyspiro[2,3-dihydro-1H-naphthalene-4,7'-3,5,6,8-tetrahydroquinazoline]-4'-one (PubChem CID 167092978) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is 2'-methylsulfanyl-6-phenylmethoxyspiro[2,3-dihydro-1H-naphthalene-4,7'-3,5,6,8-tetrahydroquinazoline]-4'-one.
| Compound Name | 2'-methylsulfanyl-6-phenylmethoxyspiro[2,3-dihydro-1H-naphthalene-4,7'-3,5,6,8-tetrahydroquinazoline]-4'-one |
|---|---|
| PubChem CID | 167092978 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 2'-methylsulfanyl-6-phenylmethoxyspiro[2,3-dihydro-1H-naphthalene-4,7'-3,5,6,8-tetrahydroquinazoline]-4'-one |
| SMILES | CSc1nc2c(c(=O)[nH]1)CCC1(CCCc3ccc(OCc4ccccc4)cc31)C2 |
| InChI | InChI=1S/C25H26N2O2S/c1-30-24-26-22-15-25(13-11-20(22)23(28)27-24)12-5-8-18-9-10-19(14-21(18)25)29-16-17-6-3-2-4-7-17/h2-4,6-7,9-10,14H,5,8,11-13,15-16H2,1H3,(H,26,27,28) |
| InChIKey | AZQUQWUKFQZWHA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |