C18H28GdN5O6S — CID 172813683
2-[4,7-bis(carboxylatomethyl)-10-(3-isothiocyanatopropyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) (PubChem CID 172813683) has the molecular formula C18H28GdN5O6S and a molecular weight of 599.77 g/mol. Its IUPAC name is 2-[4,7-bis(carboxylatomethyl)-10-(3-isothiocyanatopropyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+).
| Compound Name | 2-[4,7-bis(carboxylatomethyl)-10-(3-isothiocyanatopropyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) |
|---|---|
| PubChem CID | 172813683 |
| Molecular Formula | C18H28GdN5O6S |
| Molecular Weight | 599.77 g/mol |
| Exact Mass | 600.10 |
| IUPAC Name | 2-[4,7-bis(carboxylatomethyl)-10-(3-isothiocyanatopropyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) |
| SMILES | O=C([O-])CN1CCN(CCCN=C=S)CCN(CC(=O)[O-])CCN(CC(=O)[O-])CC1.[Gd+3] |
| InChI | InChI=1S/C18H31N5O6S.Gd/c24-16(25)12-21-6-4-20(3-1-2-19-15-30)5-7-22(13-17(26)27)9-11-23(10-8-21)14-18(28)29;/h1-14H2,(H,24,25)(H,26,27)(H,28,29);/q;+3/p-3 |
| InChIKey | SNJCURGELDMDSQ-UHFFFAOYSA-K |
| XLogP | -5.05 |
| TPSA | 145.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.77 |
| LogP ≤ 5 | -5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|