C20H35N5O8S — CID 22568645
2-[4,7-bis(carboxymethyl)-10-[2-hydroxy-3-(2-isothiocyanatoethoxy)propyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 22568645) has the molecular formula C20H35N5O8S and a molecular weight of 505.59 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-hydroxy-3-(2-isothiocyanatoethoxy)propyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-hydroxy-3-(2-isothiocyanatoethoxy)propyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 22568645 |
| Molecular Formula | C20H35N5O8S |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-hydroxy-3-(2-isothiocyanatoethoxy)propyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(O)COCCN=C=S)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C20H35N5O8S/c26-17(15-33-10-1-21-16-34)11-22-2-4-23(12-18(27)28)6-8-25(14-20(31)32)9-7-24(5-3-22)13-19(29)30/h17,26H,1-15H2,(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | ZTRWDFBYZAMSTB-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 166.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|