C21H38N4O10 — CID 89222412
2-[7-[3-[2-(carboxymethoxy)ethoxy]-2-hydroxypropyl]-4-(carboxymethyl)-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 89222412) has the molecular formula C21H38N4O10 and a molecular weight of 506.55 g/mol. Its IUPAC name is 2-[7-[3-[2-(carboxymethoxy)ethoxy]-2-hydroxypropyl]-4-(carboxymethyl)-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[7-[3-[2-(carboxymethoxy)ethoxy]-2-hydroxypropyl]-4-(carboxymethyl)-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 89222412 |
| Molecular Formula | C21H38N4O10 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 2-[7-[3-[2-(carboxymethoxy)ethoxy]-2-hydroxypropyl]-4-(carboxymethyl)-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=CCN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(O)COCCOCC(=O)O)CC1 |
| InChI | InChI=1S/C21H38N4O10/c26-10-9-22-1-3-23(13-18(27)16-34-11-12-35-17-21(32)33)5-6-25(15-20(30)31)8-7-24(4-2-22)14-19(28)29/h10,18,27H,1-9,11-17H2,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | LZEHYYLEUPRVSO-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 180.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|