C24H32N2O4 — CID 172820270
N-hydroxy-4-[[[(2R)-2-(1-hydroxycyclohexyl)-2-(4-methoxyphenyl)ethyl]-methylamino]methyl]benzamide (PubChem CID 172820270) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-hydroxy-4-[[[(2R)-2-(1-hydroxycyclohexyl)-2-(4-methoxyphenyl)ethyl]-methylamino]methyl]benzamide.
| Compound Name | N-hydroxy-4-[[[(2R)-2-(1-hydroxycyclohexyl)-2-(4-methoxyphenyl)ethyl]-methylamino]methyl]benzamide |
|---|---|
| PubChem CID | 172820270 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | N-hydroxy-4-[[[(2R)-2-(1-hydroxycyclohexyl)-2-(4-methoxyphenyl)ethyl]-methylamino]methyl]benzamide |
| SMILES | COc1ccc([C@H](CN(C)Cc2ccc(C(=O)NO)cc2)C2(O)CCCCC2)cc1 |
| InChI | InChI=1S/C24H32N2O4/c1-26(16-18-6-8-20(9-7-18)23(27)25-29)17-22(24(28)14-4-3-5-15-24)19-10-12-21(30-2)13-11-19/h6-13,22,28-29H,3-5,14-17H2,1-2H3,(H,25,27)/t22-/m0/s1 |
| InChIKey | UDCHPDHIQVEMRJ-QFIPXVFZSA-N |
| XLogP | 3.72 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|