C26H36NOS+ — CID 172821160
3,3-dibutyl-7-cyclopropyl-1-hydroxy-5-phenyl-2,4-dihydro-1,5-benzothiazepin-1-ium (PubChem CID 172821160) has the molecular formula C26H36NOS+ and a molecular weight of 410.65 g/mol. Its IUPAC name is 3,3-dibutyl-7-cyclopropyl-1-hydroxy-5-phenyl-2,4-dihydro-1,5-benzothiazepin-1-ium.
| Compound Name | 3,3-dibutyl-7-cyclopropyl-1-hydroxy-5-phenyl-2,4-dihydro-1,5-benzothiazepin-1-ium |
|---|---|
| PubChem CID | 172821160 |
| Molecular Formula | C26H36NOS+ |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 3,3-dibutyl-7-cyclopropyl-1-hydroxy-5-phenyl-2,4-dihydro-1,5-benzothiazepin-1-ium |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(C3CC3)ccc2[S+](O)C1 |
| InChI | InChI=1S/C26H36NOS/c1-3-5-16-26(17-6-4-2)19-27(23-10-8-7-9-11-23)24-18-22(21-12-13-21)14-15-25(24)29(28)20-26/h7-11,14-15,18,21,28H,3-6,12-13,16-17,19-20H2,1-2H3/q+1 |
| InChIKey | UFZLTQKXRTWBGP-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|