C26H44N10O3 — CID 172823304
[amino(dimethylamino)methylidene]-dimethylazanium;(4R)-3-[(2S)-2-azido-3-butylheptanoyl]-4-benzyl-1,3-oxazolidin-2-one;azide (PubChem CID 172823304) has the molecular formula C26H44N10O3 and a molecular weight of 544.71 g/mol. Its IUPAC name is [amino(dimethylamino)methylidene]-dimethylazanium;(4R)-3-[(2S)-2-azido-3-butylheptanoyl]-4-benzyl-1,3-oxazolidin-2-one;azide.
| Compound Name | [amino(dimethylamino)methylidene]-dimethylazanium;(4R)-3-[(2S)-2-azido-3-butylheptanoyl]-4-benzyl-1,3-oxazolidin-2-one;azide |
|---|---|
| PubChem CID | 172823304 |
| Molecular Formula | C26H44N10O3 |
| Molecular Weight | 544.71 g/mol |
| Exact Mass | 544.36 |
| IUPAC Name | [amino(dimethylamino)methylidene]-dimethylazanium;(4R)-3-[(2S)-2-azido-3-butylheptanoyl]-4-benzyl-1,3-oxazolidin-2-one;azide |
| SMILES | CCCCC(CCCC)[C@H](N=[N+]=[N-])C(=O)N1C(=O)OC[C@H]1Cc1ccccc1.CN(C)C(N)=[N+](C)C.[N-]=[N+]=[N-] |
| InChI | InChI=1S/C21H30N4O3.C5H13N3.N3/c1-3-5-12-17(13-6-4-2)19(23-24-22)20(26)25-18(15-28-21(25)27)14-16-10-8-7-9-11-16;1-7(2)5(6)8(3)4;1-3-2/h7-11,17-19H,3-6,12-15H2,1-2H3;6H,1-4H3;/q;;-1/p+1/t18-,19+;;/m1../s1 |
| InChIKey | UNBMNJMPFYYVKA-QNCHGCKQSA-O |
| XLogP | 5.25 |
| TPSA | 186.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.71 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|