C9H10N2O3 — CID 172824544
5-amino-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid (PubChem CID 172824544) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 5-amino-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid.
| Compound Name | 5-amino-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid |
|---|---|
| PubChem CID | 172824544 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 5-amino-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid |
| SMILES | Nc1cc(C(=O)O)cc2c1NCCO2 |
| InChI | InChI=1S/C9H10N2O3/c10-6-3-5(9(12)13)4-7-8(6)11-1-2-14-7/h3-4,11H,1-2,10H2,(H,12,13) |
| InChIKey | URIYMCBBLUHEHV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|