C29H39N5O7 — CID 165153049
diethyl (15E)-11,20-diamino-4-morpholin-4-yl-2,6-dioxa-13,18-diazatricyclo[17.4.0.07,12]tricosa-1(23),7,9,11,15,19,21-heptaene-9,22-dicarboxylate (PubChem CID 165153049) has the molecular formula C29H39N5O7 and a molecular weight of 569.66 g/mol. Its IUPAC name is diethyl (15E)-11,20-diamino-4-morpholin-4-yl-2,6-dioxa-13,18-diazatricyclo[17.4.0.07,12]tricosa-1(23),7,9,11,15,19,21-heptaene-9,22-dicarboxylate.
| Compound Name | diethyl (15E)-11,20-diamino-4-morpholin-4-yl-2,6-dioxa-13,18-diazatricyclo[17.4.0.07,12]tricosa-1(23),7,9,11,15,19,21-heptaene-9,22-dicarboxylate |
|---|---|
| PubChem CID | 165153049 |
| Molecular Formula | C29H39N5O7 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | diethyl (15E)-11,20-diamino-4-morpholin-4-yl-2,6-dioxa-13,18-diazatricyclo[17.4.0.07,12]tricosa-1(23),7,9,11,15,19,21-heptaene-9,22-dicarboxylate |
| SMILES | CCOC(=O)c1cc(N)c2c(c1)OCC(N1CCOCC1)COc1cc(C(=O)OCC)cc(N)c1NC/C=C/CN2 |
| InChI | InChI=1S/C29H39N5O7/c1-3-38-28(35)19-13-22(30)26-24(15-19)40-17-21(34-9-11-37-12-10-34)18-41-25-16-20(29(36)39-4-2)14-23(31)27(25)33-8-6-5-7-32-26/h5-6,13-16,21,32-33H,3-4,7-12,17-18,30-31H2,1-2H3/b6-5+ |
| InChIKey | VJTOQGMHPGEWRL-AATRIKPKSA-N |
| XLogP | 2.76 |
| TPSA | 159.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|