C19H21N2O5+ — CID 9455702
(4-ethoxycarbonylphenyl) 4-morpholin-4-ylpyridin-1-ium-2-carboxylate (PubChem CID 9455702) has the molecular formula C19H21N2O5+ and a molecular weight of 357.39 g/mol. Its IUPAC name is (4-ethoxycarbonylphenyl) 4-morpholin-4-ylpyridin-1-ium-2-carboxylate.
| Compound Name | (4-ethoxycarbonylphenyl) 4-morpholin-4-ylpyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 9455702 |
| Molecular Formula | C19H21N2O5+ |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (4-ethoxycarbonylphenyl) 4-morpholin-4-ylpyridin-1-ium-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(OC(=O)c2cc(N3CCOCC3)cc[nH+]2)cc1 |
| InChI | InChI=1S/C19H20N2O5/c1-2-25-18(22)14-3-5-16(6-4-14)26-19(23)17-13-15(7-8-20-17)21-9-11-24-12-10-21/h3-8,13H,2,9-12H2,1H3/p+1 |
| InChIKey | GADRBVWNQUZZNU-UHFFFAOYSA-O |
| XLogP | 1.73 |
| TPSA | 79.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|