C33H45N3O4 — CID 172826067
(1-aminoethylideneamino) (1S,2R,4aS,6aR,6bS,8aR,12aS,14aR,14bS)-11-cyano-1,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-2,3,4,5,6,7,8,8a,14a,14b-decahydro-1H-picene-4a-carboxylate (PubChem CID 172826067) has the molecular formula C33H45N3O4 and a molecular weight of 547.74 g/mol. Its IUPAC name is (1-aminoethylideneamino) (1S,2R,4aS,6aR,6bS,8aR,12aS,14aR,14bS)-11-cyano-1,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-2,3,4,5,6,7,8,8a,14a,14b-decahydro-1H-picene-4a-carboxylate.
| Compound Name | (1-aminoethylideneamino) (1S,2R,4aS,6aR,6bS,8aR,12aS,14aR,14bS)-11-cyano-1,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-2,3,4,5,6,7,8,8a,14a,14b-decahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 172826067 |
| Molecular Formula | C33H45N3O4 |
| Molecular Weight | 547.74 g/mol |
| Exact Mass | 547.34 |
| IUPAC Name | (1-aminoethylideneamino) (1S,2R,4aS,6aR,6bS,8aR,12aS,14aR,14bS)-11-cyano-1,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-2,3,4,5,6,7,8,8a,14a,14b-decahydro-1H-picene-4a-carboxylate |
| SMILES | CC(N)=NOC(=O)[C@]12CC[C@@H](C)[C@H](C)[C@H]1[C@H]1C(=O)C=C3[C@@]4(C)C=C(C#N)C(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C33H45N3O4/c1-18-9-12-33(28(39)40-36-20(3)35)14-13-32(8)26(25(33)19(18)2)22(37)15-24-30(6)16-21(17-34)27(38)29(4,5)23(30)10-11-31(24,32)7/h15-16,18-19,23,25-26H,9-14H2,1-8H3,(H2,35,36)/t18-,19+,23+,25+,26-,30+,31-,32-,33+/m1/s1 |
| InChIKey | UWMMJXOXXLHGJT-QQWPJFQMSA-N |
| XLogP | 5.90 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.74 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|