C23H19ClF2N4O3 — CID 172831044
6-chloro-5-fluoro-3-(2-fluoro-3-hydroxyphenyl)-4-(4-prop-2-enoylpiperazin-1-yl)quinoline-2-carboxamide (PubChem CID 172831044) has the molecular formula C23H19ClF2N4O3 and a molecular weight of 472.88 g/mol. Its IUPAC name is 6-chloro-5-fluoro-3-(2-fluoro-3-hydroxyphenyl)-4-(4-prop-2-enoylpiperazin-1-yl)quinoline-2-carboxamide.
| Compound Name | 6-chloro-5-fluoro-3-(2-fluoro-3-hydroxyphenyl)-4-(4-prop-2-enoylpiperazin-1-yl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 172831044 |
| Molecular Formula | C23H19ClF2N4O3 |
| Molecular Weight | 472.88 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 6-chloro-5-fluoro-3-(2-fluoro-3-hydroxyphenyl)-4-(4-prop-2-enoylpiperazin-1-yl)quinoline-2-carboxamide |
| SMILES | C=CC(=O)N1CCN(c2c(-c3cccc(O)c3F)c(C(N)=O)nc3ccc(Cl)c(F)c23)CC1 |
| InChI | InChI=1S/C23H19ClF2N4O3/c1-2-16(32)29-8-10-30(11-9-29)22-17(12-4-3-5-15(31)19(12)25)21(23(27)33)28-14-7-6-13(24)20(26)18(14)22/h2-7,31H,1,8-11H2,(H2,27,33) |
| InChIKey | VNACJSMBWJZPGI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.88 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|