C16H15Cl2NO4 — CID 172833288
(2S,3R)-2-(4-chloro-N-(4-chlorophenoxy)anilino)-3-hydroxybutanoic acid (PubChem CID 172833288) has the molecular formula C16H15Cl2NO4 and a molecular weight of 356.21 g/mol. Its IUPAC name is (2S,3R)-2-(4-chloro-N-(4-chlorophenoxy)anilino)-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-(4-chloro-N-(4-chlorophenoxy)anilino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 172833288 |
| Molecular Formula | C16H15Cl2NO4 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | (2S,3R)-2-(4-chloro-N-(4-chlorophenoxy)anilino)-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@@H](C(=O)O)N(Oc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2NO4/c1-10(20)15(16(21)22)19(13-6-2-11(17)3-7-13)23-14-8-4-12(18)5-9-14/h2-10,15,20H,1H3,(H,21,22)/t10-,15+/m1/s1 |
| InChIKey | VUNMIYATADYYRP-BMIGLBTASA-N |
| XLogP | 3.63 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|