C9H27N13O6 — CID 172833650
amino(carbamimidoyl)azanium;2-[bis(carboxylatomethyl)amino]acetate (PubChem CID 172833650) has the molecular formula C9H27N13O6 and a molecular weight of 413.40 g/mol. Its IUPAC name is amino(carbamimidoyl)azanium;2-[bis(carboxylatomethyl)amino]acetate.
| Compound Name | amino(carbamimidoyl)azanium;2-[bis(carboxylatomethyl)amino]acetate |
|---|---|
| PubChem CID | 172833650 |
| Molecular Formula | C9H27N13O6 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | amino(carbamimidoyl)azanium;2-[bis(carboxylatomethyl)amino]acetate |
| SMILES | O=C([O-])CN(CC(=O)[O-])CC(=O)[O-].[H]/N=C(\N)[NH2+]N.[H]/N=C(\N)[NH2+]N.[H]/N=C(\N)[NH2+]N |
| InChI | InChI=1S/C6H9NO6.3CH6N4/c8-4(9)1-7(2-5(10)11)3-6(12)13;3*2-1(3)5-4/h1-3H2,(H,8,9)(H,10,11)(H,12,13);3*4H2,(H4,2,3,5) |
| InChIKey | VVWWQAMCVLTSRV-UHFFFAOYSA-N |
| XLogP | -13.51 |
| TPSA | 401.13 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | -13.51 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|