C15H19N5OS — CID 17283410
4-[(2,4-dimethylphenyl)carbamothioylamino]-1-ethylpyrazole-3-carboxamide (PubChem CID 17283410) has the molecular formula C15H19N5OS and a molecular weight of 317.42 g/mol. Its IUPAC name is 4-[(2,4-dimethylphenyl)carbamothioylamino]-1-ethylpyrazole-3-carboxamide.
| Compound Name | 4-[(2,4-dimethylphenyl)carbamothioylamino]-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 17283410 |
| Molecular Formula | C15H19N5OS |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 4-[(2,4-dimethylphenyl)carbamothioylamino]-1-ethylpyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=S)Nc2ccc(C)cc2C)c(C(N)=O)n1 |
| InChI | InChI=1S/C15H19N5OS/c1-4-20-8-12(13(19-20)14(16)21)18-15(22)17-11-6-5-9(2)7-10(11)3/h5-8H,4H2,1-3H3,(H2,16,21)(H2,17,18,22) |
| InChIKey | JJFMVRRGZYRGFR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|