C20H20ClFN2O5 — CID 172836087
3-(4-chloro-2-fluorophenyl)-5-[4-(3,4-dimethoxyphenyl)butoxy]-1,3,4-oxadiazol-2-one (PubChem CID 172836087) has the molecular formula C20H20ClFN2O5 and a molecular weight of 422.84 g/mol. Its IUPAC name is 3-(4-chloro-2-fluorophenyl)-5-[4-(3,4-dimethoxyphenyl)butoxy]-1,3,4-oxadiazol-2-one.
| Compound Name | 3-(4-chloro-2-fluorophenyl)-5-[4-(3,4-dimethoxyphenyl)butoxy]-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 172836087 |
| Molecular Formula | C20H20ClFN2O5 |
| Molecular Weight | 422.84 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 3-(4-chloro-2-fluorophenyl)-5-[4-(3,4-dimethoxyphenyl)butoxy]-1,3,4-oxadiazol-2-one |
| SMILES | COc1ccc(CCCCOc2nn(-c3ccc(Cl)cc3F)c(=O)o2)cc1OC |
| InChI | InChI=1S/C20H20ClFN2O5/c1-26-17-9-6-13(11-18(17)27-2)5-3-4-10-28-19-23-24(20(25)29-19)16-8-7-14(21)12-15(16)22/h6-9,11-12H,3-5,10H2,1-2H3 |
| InChIKey | WEAYWTGGMBHBBL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 75.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.84 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|