C12H13Cl2NO2S — CID 172836773
N-[1-(3,5-dichloro-1-benzothiophen-2-yl)propan-2-yloxy]-N-methylhydroxylamine (PubChem CID 172836773) has the molecular formula C12H13Cl2NO2S and a molecular weight of 306.21 g/mol. Its IUPAC name is N-[1-(3,5-dichloro-1-benzothiophen-2-yl)propan-2-yloxy]-N-methylhydroxylamine.
| Compound Name | N-[1-(3,5-dichloro-1-benzothiophen-2-yl)propan-2-yloxy]-N-methylhydroxylamine |
|---|---|
| PubChem CID | 172836773 |
| Molecular Formula | C12H13Cl2NO2S |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | N-[1-(3,5-dichloro-1-benzothiophen-2-yl)propan-2-yloxy]-N-methylhydroxylamine |
| SMILES | CC(Cc1sc2ccc(Cl)cc2c1Cl)ON(C)O |
| InChI | InChI=1S/C12H13Cl2NO2S/c1-7(17-15(2)16)5-11-12(14)9-6-8(13)3-4-10(9)18-11/h3-4,6-7,16H,5H2,1-2H3 |
| InChIKey | WGGAXEXCZAERCB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|