C26H33N3O3 — CID 172839394
4-[2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4-hydroxypiperidin-1-yl]-3-morpholin-4-ylbenzaldehyde (PubChem CID 172839394) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 4-[2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4-hydroxypiperidin-1-yl]-3-morpholin-4-ylbenzaldehyde.
| Compound Name | 4-[2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4-hydroxypiperidin-1-yl]-3-morpholin-4-ylbenzaldehyde |
|---|---|
| PubChem CID | 172839394 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 4-[2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4-hydroxypiperidin-1-yl]-3-morpholin-4-ylbenzaldehyde |
| SMILES | O=Cc1ccc(N2CCC(O)CC2CN2CCc3ccccc3C2)c(N2CCOCC2)c1 |
| InChI | InChI=1S/C26H33N3O3/c30-19-20-5-6-25(26(15-20)28-11-13-32-14-12-28)29-10-8-24(31)16-23(29)18-27-9-7-21-3-1-2-4-22(21)17-27/h1-6,15,19,23-24,31H,7-14,16-18H2 |
| InChIKey | WOZVOGVJAPNUJP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|