C10H12N2S2 — CID 172844178
(4Z)-1-ethyl-4-(thiophen-3-ylmethylidene)imidazolidine-2-thione (PubChem CID 172844178) has the molecular formula C10H12N2S2 and a molecular weight of 224.35 g/mol. Its IUPAC name is (4Z)-1-ethyl-4-(thiophen-3-ylmethylidene)imidazolidine-2-thione.
| Compound Name | (4Z)-1-ethyl-4-(thiophen-3-ylmethylidene)imidazolidine-2-thione |
|---|---|
| PubChem CID | 172844178 |
| Molecular Formula | C10H12N2S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | (4Z)-1-ethyl-4-(thiophen-3-ylmethylidene)imidazolidine-2-thione |
| SMILES | CCN1C/C(=C/c2ccsc2)NC1=S |
| InChI | InChI=1S/C10H12N2S2/c1-2-12-6-9(11-10(12)13)5-8-3-4-14-7-8/h3-5,7H,2,6H2,1H3,(H,11,13)/b9-5- |
| InChIKey | XESBGXGAPSNGAP-UITAMQMPSA-N |
| XLogP | 2.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|