C11H14F3N3O2S — CID 172846453
1-(2-aminoethyl)-3-phenylthiourea;2,2,2-trifluoroacetic acid (PubChem CID 172846453) has the molecular formula C11H14F3N3O2S and a molecular weight of 309.31 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-phenylthiourea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(2-aminoethyl)-3-phenylthiourea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 172846453 |
| Molecular Formula | C11H14F3N3O2S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 1-(2-aminoethyl)-3-phenylthiourea;2,2,2-trifluoroacetic acid |
| SMILES | NCCNC(=S)Nc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H13N3S.C2HF3O2/c10-6-7-11-9(13)12-8-4-2-1-3-5-8;3-2(4,5)1(6)7/h1-5H,6-7,10H2,(H2,11,12,13);(H,6,7) |
| InChIKey | XMISRIYUEDVCHN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|