C15H20F3N3OS — CID 162536692
2,2,2-trifluoro-N-methyl-N-[(2S)-3-methyl-1-(phenylcarbamothioylamino)butan-2-yl]acetamide (PubChem CID 162536692) has the molecular formula C15H20F3N3OS and a molecular weight of 347.41 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-methyl-N-[(2S)-3-methyl-1-(phenylcarbamothioylamino)butan-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-methyl-N-[(2S)-3-methyl-1-(phenylcarbamothioylamino)butan-2-yl]acetamide |
|---|---|
| PubChem CID | 162536692 |
| Molecular Formula | C15H20F3N3OS |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2,2,2-trifluoro-N-methyl-N-[(2S)-3-methyl-1-(phenylcarbamothioylamino)butan-2-yl]acetamide |
| SMILES | CC(C)[C@@H](CNC(=S)Nc1ccccc1)N(C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C15H20F3N3OS/c1-10(2)12(21(3)13(22)15(16,17)18)9-19-14(23)20-11-7-5-4-6-8-11/h4-8,10,12H,9H2,1-3H3,(H2,19,20,23)/t12-/m1/s1 |
| InChIKey | VQGDGRMBUKKZJZ-GFCCVEGCSA-N |
| XLogP | 3.02 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|