C18H31N3S — CID 11674177
1-[2-tert-butyl-5-(dimethylamino)pentyl]-3-phenylthiourea (PubChem CID 11674177) has the molecular formula C18H31N3S and a molecular weight of 321.53 g/mol. Its IUPAC name is 1-[2-tert-butyl-5-(dimethylamino)pentyl]-3-phenylthiourea.
| Compound Name | 1-[2-tert-butyl-5-(dimethylamino)pentyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 11674177 |
| Molecular Formula | C18H31N3S |
| Molecular Weight | 321.53 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 1-[2-tert-butyl-5-(dimethylamino)pentyl]-3-phenylthiourea |
| SMILES | CN(C)CCCC(CNC(=S)Nc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C18H31N3S/c1-18(2,3)15(10-9-13-21(4)5)14-19-17(22)20-16-11-7-6-8-12-16/h6-8,11-12,15H,9-10,13-14H2,1-5H3,(H2,19,20,22) |
| InChIKey | BVTAYYNOVIQWHR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|