About 3-[4-(trifluoromethyl)phenyl]-1H-pyrrolo[1,2-b]pyrazole
3-[4-(trifluoromethyl)phenyl]-1H-pyrrolo[1,2-b]pyrazole (PubChem CID 172852374) has the molecular formula C13H9F3N2
and a molecular weight of 250.22 g/mol. Its IUPAC name is 3-[4-(trifluoromethyl)phenyl]-1H-pyrrolo[1,2-b]pyrazole.
Molecular Properties
| Compound Name | 3-[4-(trifluoromethyl)phenyl]-1H-pyrrolo[1,2-b]pyrazole |
| PubChem CID | 172852374 |
| Molecular Formula | C13H9F3N2 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 3-[4-(trifluoromethyl)phenyl]-1H-pyrrolo[1,2-b]pyrazole |
| SMILES | FC(F)(F)c1ccc(-c2c[nH]n3cccc23)cc1 |
| InChI | InChI=1S/C13H9F3N2/c14-13(15,16)10-5-3-9(4-6-10)11-8-17-18-7-1-2-12(11)18/h1-8,17H |
| InChIKey | YFWKEJBDTAURQB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[4-(trifluoromethyl)phenyl]-1H-pyrrolo[1,2-b]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(trifluoromethyl)phenyl]-1H-pyrrolo[1,2-b]pyrazole?
The IUPAC name of 3-[4-(trifluoromethyl)phenyl]-1H-pyrrolo[1,2-b]pyrazole (CID 172852374) is 3-[4-(trifluoromethyl)phenyl]-1H-pyrrolo[1,2-b]pyrazole.
What is the SMILES notation for 3-[4-(trifluoromethyl)phenyl]-1H-pyrrolo[1,2-b]pyrazole?
The canonical SMILES for 3-[4-(trifluoromethyl)phenyl]-1H-pyrrolo[1,2-b]pyrazole is FC(F)(F)c1ccc(-c2c[nH]n3cccc23)cc1.
What is the InChIKey of 3-[4-(trifluoromethyl)phenyl]-1H-pyrrolo[1,2-b]pyrazole?
The InChIKey is YFWKEJBDTAURQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9F3N2/c14-13(15,16)10-5-3-9(4-6-10)11-8-17-18-7-1-2-12(11)18/h1-8,17H.
What are the key properties of 3-[4-(trifluoromethyl)phenyl]-1H-pyrrolo[1,2-b]pyrazole?
3-[4-(trifluoromethyl)phenyl]-1H-pyrrolo[1,2-b]pyrazole has a molecular weight of 250.22 g/mol, XLogP of 3.95, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(trifluoromethyl)phenyl]-1H-pyrrolo[1,2-b]pyrazole is sourced from PubChem (CID 172852374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).