About bismuth decanoate
bismuth decanoate (PubChem CID 172855366) has the molecular formula C10H19BiO2+2
and a molecular weight of 380.24 g/mol. Its IUPAC name is bismuth decanoate.
Molecular Properties
| Compound Name | bismuth decanoate |
| PubChem CID | 172855366 |
| Molecular Formula | C10H19BiO2+2 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | bismuth decanoate |
| SMILES | CCCCCCCCCC(=O)[O-].[Bi+3] |
| InChI | InChI=1S/C10H20O2.Bi/c1-2-3-4-5-6-7-8-9-10(11)12;/h2-9H2,1H3,(H,11,12);/q;+3/p-1 |
| InChIKey | YPZQWBUSJCEBRJ-UHFFFAOYSA-M |
| XLogP | 1.50 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bismuth decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bismuth decanoate?
The IUPAC name of bismuth decanoate (CID 172855366) is bismuth decanoate.
What is the SMILES notation for bismuth decanoate?
The canonical SMILES for bismuth decanoate is CCCCCCCCCC(=O)[O-].[Bi+3].
What is the InChIKey of bismuth decanoate?
The InChIKey is YPZQWBUSJCEBRJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H20O2.Bi/c1-2-3-4-5-6-7-8-9-10(11)12;/h2-9H2,1H3,(H,11,12);/q;+3/p-1.
What are the key properties of bismuth decanoate?
bismuth decanoate has a molecular weight of 380.24 g/mol, XLogP of 1.50, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bismuth decanoate is sourced from PubChem (CID 172855366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).