C28H38N2O3 — CID 172858722
6-[4-[[1-(1-phenylethyl)piperidin-4-yl]-propanoylamino]phenyl]hexanoic acid (PubChem CID 172858722) has the molecular formula C28H38N2O3 and a molecular weight of 450.62 g/mol. Its IUPAC name is 6-[4-[[1-(1-phenylethyl)piperidin-4-yl]-propanoylamino]phenyl]hexanoic acid.
| Compound Name | 6-[4-[[1-(1-phenylethyl)piperidin-4-yl]-propanoylamino]phenyl]hexanoic acid |
|---|---|
| PubChem CID | 172858722 |
| Molecular Formula | C28H38N2O3 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | 6-[4-[[1-(1-phenylethyl)piperidin-4-yl]-propanoylamino]phenyl]hexanoic acid |
| SMILES | CCC(=O)N(c1ccc(CCCCCC(=O)O)cc1)C1CCN(C(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H38N2O3/c1-3-27(31)30(25-16-14-23(15-17-25)10-6-4-9-13-28(32)33)26-18-20-29(21-19-26)22(2)24-11-7-5-8-12-24/h5,7-8,11-12,14-17,22,26H,3-4,6,9-10,13,18-21H2,1-2H3,(H,32,33) |
| InChIKey | ZBITUSHOKYGUTB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|