C28H29FIN3O3 — CID 172865180
[4-[[[3-(2-carboxyethyl)phenyl]-(6-fluoro-2-hydroxy-1H-indol-3-yl)methylidene]amino]phenyl]methyl-trimethylazanium iodide (PubChem CID 172865180) has the molecular formula C28H29FIN3O3 and a molecular weight of 601.46 g/mol. Its IUPAC name is [4-[[[3-(2-carboxyethyl)phenyl]-(6-fluoro-2-hydroxy-1H-indol-3-yl)methylidene]amino]phenyl]methyl-trimethylazanium iodide.
| Compound Name | [4-[[[3-(2-carboxyethyl)phenyl]-(6-fluoro-2-hydroxy-1H-indol-3-yl)methylidene]amino]phenyl]methyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 172865180 |
| Molecular Formula | C28H29FIN3O3 |
| Molecular Weight | 601.46 g/mol |
| Exact Mass | 601.12 |
| IUPAC Name | [4-[[[3-(2-carboxyethyl)phenyl]-(6-fluoro-2-hydroxy-1H-indol-3-yl)methylidene]amino]phenyl]methyl-trimethylazanium iodide |
| SMILES | C[N+](C)(C)Cc1ccc(/N=C(\c2cccc(CCC(=O)O)c2)c2c(O)[nH]c3cc(F)ccc23)cc1.[I-] |
| InChI | InChI=1S/C28H28FN3O3.HI/c1-32(2,3)17-19-7-11-22(12-8-19)30-27(20-6-4-5-18(15-20)9-14-25(33)34)26-23-13-10-21(29)16-24(23)31-28(26)35;/h4-8,10-13,15-16H,9,14,17H2,1-3H3,(H2-,30,31,33,34,35);1H |
| InChIKey | ZWWBAWZDGSEDEW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 85.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|