C19H31N — CID 172866001
(3-methanidyl-3,5,5-trimethylcyclohexyl)-methyl-(2-phenylethyl)azanium (PubChem CID 172866001) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is (3-methanidyl-3,5,5-trimethylcyclohexyl)-methyl-(2-phenylethyl)azanium.
| Compound Name | (3-methanidyl-3,5,5-trimethylcyclohexyl)-methyl-(2-phenylethyl)azanium |
|---|---|
| PubChem CID | 172866001 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | (3-methanidyl-3,5,5-trimethylcyclohexyl)-methyl-(2-phenylethyl)azanium |
| SMILES | [CH2-]C1(C)CC([NH+](C)CCc2ccccc2)CC(C)(C)C1 |
| InChI | InChI=1S/C19H30N/c1-18(2)13-17(14-19(3,4)15-18)20(5)12-11-16-9-7-6-8-10-16/h6-10,17H,1,11-15H2,2-5H3/q-1/p+1 |
| InChIKey | ZZRLAFAOIXZXKC-UHFFFAOYSA-O |
| XLogP | 3.16 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|