C20H21ClFN3O3S — CID 172887258
4-chloro-2-fluoro-N-[[4-(4-prop-2-enoylpiperazin-1-yl)phenyl]methyl]benzenesulfonamide (PubChem CID 172887258) has the molecular formula C20H21ClFN3O3S and a molecular weight of 437.92 g/mol. Its IUPAC name is 4-chloro-2-fluoro-N-[[4-(4-prop-2-enoylpiperazin-1-yl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 4-chloro-2-fluoro-N-[[4-(4-prop-2-enoylpiperazin-1-yl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 172887258 |
| Molecular Formula | C20H21ClFN3O3S |
| Molecular Weight | 437.92 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 4-chloro-2-fluoro-N-[[4-(4-prop-2-enoylpiperazin-1-yl)phenyl]methyl]benzenesulfonamide |
| SMILES | C=CC(=O)N1CCN(c2ccc(CNS(=O)(=O)c3ccc(Cl)cc3F)cc2)CC1 |
| InChI | InChI=1S/C20H21ClFN3O3S/c1-2-20(26)25-11-9-24(10-12-25)17-6-3-15(4-7-17)14-23-29(27,28)19-8-5-16(21)13-18(19)22/h2-8,13,23H,1,9-12,14H2 |
| InChIKey | MAHCTMAPCLKNKH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.92 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|